C17H21NO4S — CID 86718873
7-(3-pyrrolidin-1-ylpropoxy)naphthalene-2-sulfonic acid (PubChem CID 86718873) has the molecular formula C17H21NO4S and a molecular weight of 335.42 g/mol. Its IUPAC name is 7-(3-pyrrolidin-1-ylpropoxy)naphthalene-2-sulfonic acid.
| Compound Name | 7-(3-pyrrolidin-1-ylpropoxy)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 86718873 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 7-(3-pyrrolidin-1-ylpropoxy)naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2ccc(OCCCN3CCCC3)cc2c1 |
| InChI | InChI=1S/C17H21NO4S/c19-23(20,21)17-7-5-14-4-6-16(12-15(14)13-17)22-11-3-10-18-8-1-2-9-18/h4-7,12-13H,1-3,8-11H2,(H,19,20,21) |
| InChIKey | UKGCHBOYAONLCY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|