C23H28N2O5S2 — CID 69130162
2,5-bis(methylsulfonyl)-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]indole (PubChem CID 69130162) has the molecular formula C23H28N2O5S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2,5-bis(methylsulfonyl)-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]indole.
| Compound Name | 2,5-bis(methylsulfonyl)-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]indole |
|---|---|
| PubChem CID | 69130162 |
| Molecular Formula | C23H28N2O5S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2,5-bis(methylsulfonyl)-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]indole |
| SMILES | CS(=O)(=O)c1ccc2c(c1)cc(S(C)(=O)=O)n2-c1ccc(OCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C23H28N2O5S2/c1-31(26,27)21-10-11-22-18(16-21)17-23(32(2,28)29)25(22)19-6-8-20(9-7-19)30-15-5-14-24-12-3-4-13-24/h6-11,16-17H,3-5,12-15H2,1-2H3 |
| InChIKey | HMWJBVJFZDQNGM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|