C15H24N2O3 — CID 22012920
3-(3-nitrophenoxy)-N,N-dipropylpropan-1-amine (PubChem CID 22012920) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-(3-nitrophenoxy)-N,N-dipropylpropan-1-amine.
| Compound Name | 3-(3-nitrophenoxy)-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 22012920 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-(3-nitrophenoxy)-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCOc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H24N2O3/c1-3-9-16(10-4-2)11-6-12-20-15-8-5-7-14(13-15)17(18)19/h5,7-8,13H,3-4,6,9-12H2,1-2H3 |
| InChIKey | NBNGHXVBOBDLCU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|