C14H23N3O3 — CID 2966104
N',N'-dimethyl-N-[4-(3-nitrophenoxy)butyl]ethane-1,2-diamine (PubChem CID 2966104) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is N',N'-dimethyl-N-[4-(3-nitrophenoxy)butyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[4-(3-nitrophenoxy)butyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 2966104 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N',N'-dimethyl-N-[4-(3-nitrophenoxy)butyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCCCCOc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H23N3O3/c1-16(2)10-9-15-8-3-4-11-20-14-7-5-6-13(12-14)17(18)19/h5-7,12,15H,3-4,8-11H2,1-2H3 |
| InChIKey | LQJJFHFZXBNAPE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|