C15H8O5 — CID 143619617
5,7-dihydroxy-9,10-dioxoanthracene-2-carbaldehyde (PubChem CID 143619617) has the molecular formula C15H8O5 and a molecular weight of 268.22 g/mol. Its IUPAC name is 5,7-dihydroxy-9,10-dioxoanthracene-2-carbaldehyde.
| Compound Name | 5,7-dihydroxy-9,10-dioxoanthracene-2-carbaldehyde |
|---|---|
| PubChem CID | 143619617 |
| Molecular Formula | C15H8O5 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 5,7-dihydroxy-9,10-dioxoanthracene-2-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)C(=O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C15H8O5/c16-6-7-1-2-9-10(3-7)14(19)11-4-8(17)5-12(18)13(11)15(9)20/h1-6,17-18H |
| InChIKey | WBRBTWCFSFMVGG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|