C21H22N4O8 — CID 69302145
2-amino-5-(diaminomethylideneamino)pentanoic acid;5,7-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 69302145) has the molecular formula C21H22N4O8 and a molecular weight of 458.43 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;5,7-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;5,7-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 69302145 |
| Molecular Formula | C21H22N4O8 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;5,7-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=C(O)c1ccc2c(c1)C(=O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C15H8O6.C6H14N4O2/c16-7-4-10-12(11(17)5-7)14(19)8-2-1-6(15(20)21)3-9(8)13(10)18;7-4(5(11)12)2-1-3-10-6(8)9/h1-5,16-17H,(H,20,21);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | BOBQBXWKOYIDND-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 239.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|