C10H25N5O5 — CID 118498709
2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 118498709) has the molecular formula C10H25N5O5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 118498709 |
| Molecular Formula | C10H25N5O5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | NC(CO)(CO)CO.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C4H11NO3/c7-4(5(11)12)2-1-3-10-6(8)9;5-4(1-6,2-7)3-8/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);6-8H,1-3,5H2 |
| InChIKey | GGNVCFSNSJGZRA-UHFFFAOYSA-N |
| XLogP | -3.89 |
| TPSA | 214.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|