C9H8F2O2 — CID 63269959
3-(2,5-difluorophenoxy)propanal (PubChem CID 63269959) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is 3-(2,5-difluorophenoxy)propanal.
| Compound Name | 3-(2,5-difluorophenoxy)propanal |
|---|---|
| PubChem CID | 63269959 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(2,5-difluorophenoxy)propanal |
| SMILES | O=CCCOc1cc(F)ccc1F |
| InChI | InChI=1S/C9H8F2O2/c10-7-2-3-8(11)9(6-7)13-5-1-4-12/h2-4,6H,1,5H2 |
| InChIKey | TYRLVUPAZQIAGP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|