C21H30Cl4N2O3 — CID 17214144
2-[3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propylamino]ethanol;dihydrochloride (PubChem CID 17214144) has the molecular formula C21H30Cl4N2O3 and a molecular weight of 500.29 g/mol. Its IUPAC name is 2-[3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propylamino]ethanol;dihydrochloride.
| Compound Name | 2-[3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17214144 |
| Molecular Formula | C21H30Cl4N2O3 |
| Molecular Weight | 500.29 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-[3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propylamino]ethanol;dihydrochloride |
| SMILES | CCOc1cc(CNCCCNCCO)cc(Cl)c1OCc1ccc(Cl)cc1.Cl.Cl |
| InChI | InChI=1S/C21H28Cl2N2O3.2ClH/c1-2-27-20-13-17(14-25-9-3-8-24-10-11-26)12-19(23)21(20)28-15-16-4-6-18(22)7-5-16;;/h4-7,12-13,24-26H,2-3,8-11,14-15H2,1H3;2*1H |
| InChIKey | DJXWLAXXMOGSCJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|