C15H27Cl3N2O3 — CID 17214212
2-[3-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]propylamino]ethanol;dihydrochloride (PubChem CID 17214212) has the molecular formula C15H27Cl3N2O3 and a molecular weight of 389.75 g/mol. Its IUPAC name is 2-[3-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]propylamino]ethanol;dihydrochloride.
| Compound Name | 2-[3-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]propylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17214212 |
| Molecular Formula | C15H27Cl3N2O3 |
| Molecular Weight | 389.75 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[3-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]propylamino]ethanol;dihydrochloride |
| SMILES | CCOc1cc(CNCCCNCCO)cc(Cl)c1OC.Cl.Cl |
| InChI | InChI=1S/C15H25ClN2O3.2ClH/c1-3-21-14-10-12(9-13(16)15(14)20-2)11-18-6-4-5-17-7-8-19;;/h9-10,17-19H,3-8,11H2,1-2H3;2*1H |
| InChIKey | YDAGTSDROOTYLI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|