C14H10ClNOS — CID 80740820
2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]phenol (PubChem CID 80740820) has the molecular formula C14H10ClNOS and a molecular weight of 275.76 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]phenol.
| Compound Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 80740820 |
| Molecular Formula | C14H10ClNOS |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]phenol |
| SMILES | Oc1ccccc1Cc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C14H10ClNOS/c15-10-5-6-11-13(8-10)18-14(16-11)7-9-3-1-2-4-12(9)17/h1-6,8,17H,7H2 |
| InChIKey | BITUFWBGHDMNQL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |