C17H17ClN2S — CID 79525572
6-chloro-N-(2,6-diethylphenyl)-1,3-benzothiazol-2-amine (PubChem CID 79525572) has the molecular formula C17H17ClN2S and a molecular weight of 316.86 g/mol. Its IUPAC name is 6-chloro-N-(2,6-diethylphenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(2,6-diethylphenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79525572 |
| Molecular Formula | C17H17ClN2S |
| Molecular Weight | 316.86 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 6-chloro-N-(2,6-diethylphenyl)-1,3-benzothiazol-2-amine |
| SMILES | CCc1cccc(CC)c1Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C17H17ClN2S/c1-3-11-6-5-7-12(4-2)16(11)20-17-19-14-9-8-13(18)10-15(14)21-17/h5-10H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | RFGHATPKFCBFRU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.86 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |