C16H15ClN2S — CID 79527732
6-chloro-N-(2-ethyl-6-methylphenyl)-1,3-benzothiazol-2-amine (PubChem CID 79527732) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is 6-chloro-N-(2-ethyl-6-methylphenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(2-ethyl-6-methylphenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79527732 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 6-chloro-N-(2-ethyl-6-methylphenyl)-1,3-benzothiazol-2-amine |
| SMILES | CCc1cccc(C)c1Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C16H15ClN2S/c1-3-11-6-4-5-10(2)15(11)19-16-18-13-8-7-12(17)9-14(13)20-16/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | IJEHSKDVKGWGBE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |