C17H18N2O2S — CID 112761133
4-(1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-N-methylbutanamide (PubChem CID 112761133) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-N-methylbutanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-N-methylbutanamide |
|---|---|
| PubChem CID | 112761133 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-N-methylbutanamide |
| SMILES | CN(Cc1ccco1)C(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H18N2O2S/c1-19(12-13-6-5-11-21-13)17(20)10-4-9-16-18-14-7-2-3-8-15(14)22-16/h2-3,5-8,11H,4,9-10,12H2,1H3 |
| InChIKey | PRJYZLFOBOVZQF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |