C21H23FN2O2S — CID 78800940
5-(1,3-benzothiazol-2-yl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpentanamide (PubChem CID 78800940) has the molecular formula C21H23FN2O2S and a molecular weight of 386.49 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 78800940 |
| Molecular Formula | C21H23FN2O2S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methylpentanamide |
| SMILES | COc1ccc(CN(C)C(=O)CCCCc2nc3ccccc3s2)cc1F |
| InChI | InChI=1S/C21H23FN2O2S/c1-24(14-15-11-12-18(26-2)16(22)13-15)21(25)10-6-5-9-20-23-17-7-3-4-8-19(17)27-20/h3-4,7-8,11-13H,5-6,9-10,14H2,1-2H3 |
| InChIKey | CTBRKGMPBOWJHF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|