C24H24N2O3S — CID 78821884
5-(1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]pentanamide (PubChem CID 78821884) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 78821884 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]pentanamide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)N(Cc1ccco1)Cc1ccccc1O |
| InChI | InChI=1S/C24H24N2O3S/c27-21-11-3-1-8-18(21)16-26(17-19-9-7-15-29-19)24(28)14-6-5-13-23-25-20-10-2-4-12-22(20)30-23/h1-4,7-12,15,27H,5-6,13-14,16-17H2 |
| InChIKey | KEUGIAULYXXRCY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|