C20H23N5O — CID 52626682
1-[3-(N-methylanilino)propyl]-3-(2-pyrazol-1-ylphenyl)urea (PubChem CID 52626682) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[3-(N-methylanilino)propyl]-3-(2-pyrazol-1-ylphenyl)urea.
| Compound Name | 1-[3-(N-methylanilino)propyl]-3-(2-pyrazol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 52626682 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-[3-(N-methylanilino)propyl]-3-(2-pyrazol-1-ylphenyl)urea |
| SMILES | CN(CCCNC(=O)Nc1ccccc1-n1cccn1)c1ccccc1 |
| InChI | InChI=1S/C20H23N5O/c1-24(17-9-3-2-4-10-17)15-7-13-21-20(26)23-18-11-5-6-12-19(18)25-16-8-14-22-25/h2-6,8-12,14,16H,7,13,15H2,1H3,(H2,21,23,26) |
| InChIKey | XTBSNHRGMYMUJM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|