C14H20N6O3S — CID 47041234
1-[3-[methyl(methylsulfonyl)amino]propyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea (PubChem CID 47041234) has the molecular formula C14H20N6O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-[3-[methyl(methylsulfonyl)amino]propyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea.
| Compound Name | 1-[3-[methyl(methylsulfonyl)amino]propyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 47041234 |
| Molecular Formula | C14H20N6O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-[3-[methyl(methylsulfonyl)amino]propyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea |
| SMILES | CN(CCCNC(=O)Nc1cccnc1-n1cccn1)S(C)(=O)=O |
| InChI | InChI=1S/C14H20N6O3S/c1-19(24(2,22)23)10-4-8-16-14(21)18-12-6-3-7-15-13(12)20-11-5-9-17-20/h3,5-7,9,11H,4,8,10H2,1-2H3,(H2,16,18,21) |
| InChIKey | RPPRGALPNFGLDF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|