C23H29N7O — CID 51116547
1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea (PubChem CID 51116547) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea.
| Compound Name | 1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 51116547 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-(2-pyrazol-1-yl-3-pyridinyl)urea |
| SMILES | CN1CCN(CCCNC(=O)Nc2cccnc2-n2cccn2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C23H29N7O/c1-28-16-17-29(21(18-28)19-8-3-2-4-9-19)14-6-12-25-23(31)27-20-10-5-11-24-22(20)30-15-7-13-26-30/h2-5,7-11,13,15,21H,6,12,14,16-18H2,1H3,(H2,25,27,31) |
| InChIKey | DKYMURWGBMPBJE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|