C26H35N5O2 — CID 78891165
1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea (PubChem CID 78891165) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 78891165 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea |
| SMILES | CN1CCN(CCCNC(=O)Nc2ccc(CN3CCCC3=O)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C26H35N5O2/c1-29-17-18-30(24(20-29)22-7-3-2-4-8-22)16-6-14-27-26(33)28-23-12-10-21(11-13-23)19-31-15-5-9-25(31)32/h2-4,7-8,10-13,24H,5-6,9,14-20H2,1H3,(H2,27,28,33) |
| InChIKey | OERXYXIAPYSQSG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|