C22H28ClN3OS — CID 42957275
2-chloro-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-5-methylsulfanylbenzamide (PubChem CID 42957275) has the molecular formula C22H28ClN3OS and a molecular weight of 418.01 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 42957275 |
| Molecular Formula | C22H28ClN3OS |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2-chloro-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NCCCN2CCN(C)CC2c2ccccc2)c1 |
| InChI | InChI=1S/C22H28ClN3OS/c1-25-13-14-26(21(16-25)17-7-4-3-5-8-17)12-6-11-24-22(27)19-15-18(28-2)9-10-20(19)23/h3-5,7-10,15,21H,6,11-14,16H2,1-2H3,(H,24,27) |
| InChIKey | OVTRDPWFOIPCMU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|