C25H34N4O2 — CID 78890347
1-[2-(diethylamino)-3-phenylpropyl]-3-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea (PubChem CID 78890347) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-[2-(diethylamino)-3-phenylpropyl]-3-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[2-(diethylamino)-3-phenylpropyl]-3-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 78890347 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 1-[2-(diethylamino)-3-phenylpropyl]-3-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea |
| SMILES | CCN(CC)C(CNC(=O)Nc1ccc(CN2CCCC2=O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H34N4O2/c1-3-28(4-2)23(17-20-9-6-5-7-10-20)18-26-25(31)27-22-14-12-21(13-15-22)19-29-16-8-11-24(29)30/h5-7,9-10,12-15,23H,3-4,8,11,16-19H2,1-2H3,(H2,26,27,31) |
| InChIKey | YONDFYDMQNYXRL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |