C21H30F2N4O3 — CID 124885878
2,2-difluoro-N-[3-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propyl]-3-morpholin-4-yl-3-oxopropanamide (PubChem CID 124885878) has the molecular formula C21H30F2N4O3 and a molecular weight of 424.49 g/mol. Its IUPAC name is 2,2-difluoro-N-[3-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propyl]-3-morpholin-4-yl-3-oxopropanamide.
| Compound Name | 2,2-difluoro-N-[3-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propyl]-3-morpholin-4-yl-3-oxopropanamide |
|---|---|
| PubChem CID | 124885878 |
| Molecular Formula | C21H30F2N4O3 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 2,2-difluoro-N-[3-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propyl]-3-morpholin-4-yl-3-oxopropanamide |
| SMILES | CN1CCN(CCCNC(=O)C(F)(F)C(=O)N2CCOCC2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H30F2N4O3/c1-25-10-11-26(18(16-25)17-6-3-2-4-7-17)9-5-8-24-19(28)21(22,23)20(29)27-12-14-30-15-13-27/h2-4,6-7,18H,5,8-16H2,1H3,(H,24,28)/t18-/m0/s1 |
| InChIKey | BWLRLYAGBFDPSR-SFHVURJKSA-N |
| XLogP | 0.98 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|