C22H37N5 — CID 111211763
N',4-dimethyl-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]piperidine-1-carboximidamide (PubChem CID 111211763) has the molecular formula C22H37N5 and a molecular weight of 371.57 g/mol. Its IUPAC name is N',4-dimethyl-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]piperidine-1-carboximidamide.
| Compound Name | N',4-dimethyl-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111211763 |
| Molecular Formula | C22H37N5 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | N',4-dimethyl-N-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCN1CCN(C)CC1c1ccccc1)N1CCC(C)CC1 |
| InChI | InChI=1S/C22H37N5/c1-19-10-14-27(15-11-19)22(23-2)24-12-7-13-26-17-16-25(3)18-21(26)20-8-5-4-6-9-20/h4-6,8-9,19,21H,7,10-18H2,1-3H3,(H,23,24) |
| InChIKey | ZCFVJSPTMHQWKN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|