C17H19ClFN3O — CID 52543085
1-(2-chloro-4-fluorophenyl)-3-[3-(N-methylanilino)propyl]urea (PubChem CID 52543085) has the molecular formula C17H19ClFN3O and a molecular weight of 335.81 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3-[3-(N-methylanilino)propyl]urea.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3-[3-(N-methylanilino)propyl]urea |
|---|---|
| PubChem CID | 52543085 |
| Molecular Formula | C17H19ClFN3O |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3-[3-(N-methylanilino)propyl]urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(F)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H19ClFN3O/c1-22(14-6-3-2-4-7-14)11-5-10-20-17(23)21-16-9-8-13(19)12-15(16)18/h2-4,6-9,12H,5,10-11H2,1H3,(H2,20,21,23) |
| InChIKey | LWHJHIWZAOKCCX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|