C20H26ClN3O3 — CID 60594806
1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[3-(N-methylanilino)propyl]urea (PubChem CID 60594806) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[3-(N-methylanilino)propyl]urea.
| Compound Name | 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[3-(N-methylanilino)propyl]urea |
|---|---|
| PubChem CID | 60594806 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[3-(N-methylanilino)propyl]urea |
| SMILES | COCCOc1c(Cl)cccc1NC(=O)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C20H26ClN3O3/c1-24(16-8-4-3-5-9-16)13-7-12-22-20(25)23-18-11-6-10-17(21)19(18)27-15-14-26-2/h3-6,8-11H,7,12-15H2,1-2H3,(H2,22,23,25) |
| InChIKey | LGVBIDVRLMNTJO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|