C20H26N4O3 — CID 72888813
2-methoxy-N-[2-methyl-3-[2-(N-methylanilino)ethylcarbamoylamino]phenyl]acetamide (PubChem CID 72888813) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-methoxy-N-[2-methyl-3-[2-(N-methylanilino)ethylcarbamoylamino]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[2-methyl-3-[2-(N-methylanilino)ethylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 72888813 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-methoxy-N-[2-methyl-3-[2-(N-methylanilino)ethylcarbamoylamino]phenyl]acetamide |
| SMILES | COCC(=O)Nc1cccc(NC(=O)NCCN(C)c2ccccc2)c1C |
| InChI | InChI=1S/C20H26N4O3/c1-15-17(22-19(25)14-27-3)10-7-11-18(15)23-20(26)21-12-13-24(2)16-8-5-4-6-9-16/h4-11H,12-14H2,1-3H3,(H,22,25)(H2,21,23,26) |
| InChIKey | VEUKWRZAZLWXLW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |