C16H19N5O5 — CID 87848916
N-[(2S)-1-(cyanomethylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 87848916) has the molecular formula C16H19N5O5 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-(cyanomethylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 87848916 |
| Molecular Formula | C16H19N5O5 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | N#CCNC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H19N5O5/c17-5-6-18-15(22)14(19-16(23)20-7-9-26-10-8-20)11-12-1-3-13(4-2-12)21(24)25/h1-4,14H,6-11H2,(H,18,22)(H,19,23)/t14-/m0/s1 |
| InChIKey | DHXQQFMEQZKRDW-AWEZNQCLSA-N |
| XLogP | 0.19 |
| TPSA | 137.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|