C14H24N4O3S2 — CID 18381704
N-[3-(tert-butyldisulfanyl)-1-(cyanomethylamino)-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 18381704) has the molecular formula C14H24N4O3S2 and a molecular weight of 360.51 g/mol. Its IUPAC name is N-[3-(tert-butyldisulfanyl)-1-(cyanomethylamino)-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[3-(tert-butyldisulfanyl)-1-(cyanomethylamino)-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 18381704 |
| Molecular Formula | C14H24N4O3S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[3-(tert-butyldisulfanyl)-1-(cyanomethylamino)-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | CC(C)(C)SSCC(NC(=O)N1CCOCC1)C(=O)NCC#N |
| InChI | InChI=1S/C14H24N4O3S2/c1-14(2,3)23-22-10-11(12(19)16-5-4-15)17-13(20)18-6-8-21-9-7-18/h11H,5-10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | NUFZKRFYODQAMW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|