C31H34N4O5 — CID 54145957
N-[(2S)-1-[3-[1-(4-nitrophenyl)pent-1-enyl]anilino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide (PubChem CID 54145957) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is N-[(2S)-1-[3-[1-(4-nitrophenyl)pent-1-enyl]anilino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-[3-[1-(4-nitrophenyl)pent-1-enyl]anilino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 54145957 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | N-[(2S)-1-[3-[1-(4-nitrophenyl)pent-1-enyl]anilino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide |
| SMILES | CCCC=C(c1ccc([N+](=O)[O-])cc1)c1cccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C31H34N4O5/c1-2-3-12-28(24-13-15-27(16-14-24)35(38)39)25-10-7-11-26(22-25)32-30(36)29(21-23-8-5-4-6-9-23)33-31(37)34-17-19-40-20-18-34/h4-16,22,29H,2-3,17-21H2,1H3,(H,32,36)(H,33,37)/t29-/m0/s1 |
| InChIKey | OEJYPYWKTJYHKY-LJAQVGFWSA-N |
| XLogP | 5.42 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|