C24H23F3N3O5- — CID 161251538
N-[1-[[4-(difluoromethyl)-2-oxochromen-7-yl]amino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide fluoride (PubChem CID 161251538) has the molecular formula C24H23F3N3O5- and a molecular weight of 490.46 g/mol. Its IUPAC name is N-[1-[[4-(difluoromethyl)-2-oxochromen-7-yl]amino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide fluoride.
| Compound Name | N-[1-[[4-(difluoromethyl)-2-oxochromen-7-yl]amino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide fluoride |
|---|---|
| PubChem CID | 161251538 |
| Molecular Formula | C24H23F3N3O5- |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[1-[[4-(difluoromethyl)-2-oxochromen-7-yl]amino]-1-oxo-3-phenylpropan-2-yl]morpholine-4-carboxamide fluoride |
| SMILES | O=C(Nc1ccc2c(C(F)F)cc(=O)oc2c1)C(Cc1ccccc1)NC(=O)N1CCOCC1.[F-] |
| InChI | InChI=1S/C24H23F2N3O5.FH/c25-22(26)18-14-21(30)34-20-13-16(6-7-17(18)20)27-23(31)19(12-15-4-2-1-3-5-15)28-24(32)29-8-10-33-11-9-29;/h1-7,13-14,19,22H,8-12H2,(H,27,31)(H,28,32);1H/p-1 |
| InChIKey | VBIKQKQMMUHWAF-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|