C21H22N4O3 — CID 87926841
N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-5-ylcarbamoylamino)-3-(4-hydroxyphenyl)propanamide (PubChem CID 87926841) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-5-ylcarbamoylamino)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-5-ylcarbamoylamino)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 87926841 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-5-ylcarbamoylamino)-3-(4-hydroxyphenyl)propanamide |
| SMILES | N#CCNC(=O)C(Cc1ccc(O)cc1)NC(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C21H22N4O3/c22-10-11-23-20(27)19(12-14-4-8-18(26)9-5-14)25-21(28)24-17-7-6-15-2-1-3-16(15)13-17/h4-9,13,19,26H,1-3,11-12H2,(H,23,27)(H2,24,25,28) |
| InChIKey | TWFBTWSOYQLZGH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|