C18H19ClN4O4 — CID 154786229
3-[[2-amino-1-(4-chlorophenyl)-2-oxoethyl]amino]-N-(4-nitrophenyl)butanamide (PubChem CID 154786229) has the molecular formula C18H19ClN4O4 and a molecular weight of 390.83 g/mol. Its IUPAC name is 3-[[2-amino-1-(4-chlorophenyl)-2-oxoethyl]amino]-N-(4-nitrophenyl)butanamide.
| Compound Name | 3-[[2-amino-1-(4-chlorophenyl)-2-oxoethyl]amino]-N-(4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 154786229 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-[[2-amino-1-(4-chlorophenyl)-2-oxoethyl]amino]-N-(4-nitrophenyl)butanamide |
| SMILES | CC(CC(=O)Nc1ccc([N+](=O)[O-])cc1)NC(C(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN4O4/c1-11(21-17(18(20)25)12-2-4-13(19)5-3-12)10-16(24)22-14-6-8-15(9-7-14)23(26)27/h2-9,11,17,21H,10H2,1H3,(H2,20,25)(H,22,24) |
| InChIKey | HLEWKZUKIACYCQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|