C10H5F7O2 — CID 162738000
2,2-difluoro-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]acetic acid (PubChem CID 162738000) has the molecular formula C10H5F7O2 and a molecular weight of 290.13 g/mol. Its IUPAC name is 2,2-difluoro-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]acetic acid.
| Compound Name | 2,2-difluoro-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 162738000 |
| Molecular Formula | C10H5F7O2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2,2-difluoro-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(F)(F)c1cccc(C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F7O2/c11-8(12,7(18)19)5-2-1-3-6(4-5)9(13,14)10(15,16)17/h1-4H,(H,18,19) |
| InChIKey | OZAIVSSPHKNODZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|