About 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide
9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide (PubChem CID 21394884) has the molecular formula C25H21F3N4
and a molecular weight of 434.47 g/mol. Its IUPAC name is 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide.
Molecular Properties
| Compound Name | 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide |
| PubChem CID | 21394884 |
| Molecular Formula | C25H21F3N4 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide |
| SMILES | CCCCn1c2ccc(C#N)cc2c2cc(/C(N)=N/c3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C25H21F3N4/c1-2-3-11-32-22-9-7-16(15-29)12-20(22)21-13-17(8-10-23(21)32)24(30)31-19-6-4-5-18(14-19)25(26,27)28/h4-10,12-14H,2-3,11H2,1H3,(H2,30,31) |
| InChIKey | PAYOPDNGFNGSNF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 67.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide?
The IUPAC name of 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide (CID 21394884) is 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide.
What is the SMILES notation for 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide?
The canonical SMILES for 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide is CCCCn1c2ccc(C#N)cc2c2cc(/C(N)=N/c3cccc(C(F)(F)F)c3)ccc21.
What is the InChIKey of 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide?
The InChIKey is PAYOPDNGFNGSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21F3N4/c1-2-3-11-32-22-9-7-16(15-29)12-20(22)21-13-17(8-10-23(21)32)24(30)31-19-6-4-5-18(14-19)25(26,27)28/h4-10,12-14H,2-3,11H2,1H3,(H2,30,31).
What are the key properties of 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide?
9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide has a molecular weight of 434.47 g/mol, XLogP of 6.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butyl-6-cyano-N'-[3-(trifluoromethyl)phenyl]carbazole-3-carboximidamide is sourced from PubChem (CID 21394884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).