C14H9F3N2O4 — CID 101365276
(2,5-dioxopyrrolidin-1-yl) 4-[2-(trifluoromethyl)azirin-2-yl]benzoate (PubChem CID 101365276) has the molecular formula C14H9F3N2O4 and a molecular weight of 326.23 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[2-(trifluoromethyl)azirin-2-yl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-(trifluoromethyl)azirin-2-yl]benzoate |
|---|---|
| PubChem CID | 101365276 |
| Molecular Formula | C14H9F3N2O4 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-(trifluoromethyl)azirin-2-yl]benzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(C2(C(F)(F)F)C=N2)cc1 |
| InChI | InChI=1S/C14H9F3N2O4/c15-14(16,17)13(7-18-13)9-3-1-8(2-4-9)12(22)23-19-10(20)5-6-11(19)21/h1-4,7H,5-6H2 |
| InChIKey | RVRVYSIZAYZQPX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|