C16H13FN2O3 — CID 162507635
1-[3-(4-fluorophenoxy)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 162507635) has the molecular formula C16H13FN2O3 and a molecular weight of 300.29 g/mol. Its IUPAC name is 1-[3-(4-fluorophenoxy)phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[3-(4-fluorophenoxy)phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 162507635 |
| Molecular Formula | C16H13FN2O3 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-[3-(4-fluorophenoxy)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cccc(Oc3ccc(F)cc3)c2)C(=O)N1 |
| InChI | InChI=1S/C16H13FN2O3/c17-11-4-6-13(7-5-11)22-14-3-1-2-12(10-14)19-9-8-15(20)18-16(19)21/h1-7,10H,8-9H2,(H,18,20,21) |
| InChIKey | DLFHOLBMPPUIHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |