C21H35N3O3S2 — CID 142514357
methyl (2S)-2-amino-5-[4-(diethylcarbamothioylsulfanylmethyl)anilino]-5-oxopentanoate;propane (PubChem CID 142514357) has the molecular formula C21H35N3O3S2 and a molecular weight of 441.66 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-[4-(diethylcarbamothioylsulfanylmethyl)anilino]-5-oxopentanoate;propane.
| Compound Name | methyl (2S)-2-amino-5-[4-(diethylcarbamothioylsulfanylmethyl)anilino]-5-oxopentanoate;propane |
|---|---|
| PubChem CID | 142514357 |
| Molecular Formula | C21H35N3O3S2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | methyl (2S)-2-amino-5-[4-(diethylcarbamothioylsulfanylmethyl)anilino]-5-oxopentanoate;propane |
| SMILES | CCC.CCN(CC)C(=S)SCc1ccc(NC(=O)CC[C@H](N)C(=O)OC)cc1 |
| InChI | InChI=1S/C18H27N3O3S2.C3H8/c1-4-21(5-2)18(25)26-12-13-6-8-14(9-7-13)20-16(22)11-10-15(19)17(23)24-3;1-3-2/h6-9,15H,4-5,10-12,19H2,1-3H3,(H,20,22);3H2,1-2H3/t15-;/m0./s1 |
| InChIKey | BFAZRSRRLTZZRF-RSAXXLAASA-N |
| XLogP | 4.18 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|