C13H16BrNO3 — CID 103137017
(5-methyloxolan-2-yl)methyl 5-amino-2-bromobenzoate (PubChem CID 103137017) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is (5-methyloxolan-2-yl)methyl 5-amino-2-bromobenzoate.
| Compound Name | (5-methyloxolan-2-yl)methyl 5-amino-2-bromobenzoate |
|---|---|
| PubChem CID | 103137017 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | (5-methyloxolan-2-yl)methyl 5-amino-2-bromobenzoate |
| SMILES | CC1CCC(COC(=O)c2cc(N)ccc2Br)O1 |
| InChI | InChI=1S/C13H16BrNO3/c1-8-2-4-10(18-8)7-17-13(16)11-6-9(15)3-5-12(11)14/h3,5-6,8,10H,2,4,7,15H2,1H3 |
| InChIKey | KVQMVILKGUZIDX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|