C15H21NO3 — CID 103137050
(5-methyloxolan-2-yl)methyl 3-(3-aminophenyl)propanoate (PubChem CID 103137050) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (5-methyloxolan-2-yl)methyl 3-(3-aminophenyl)propanoate.
| Compound Name | (5-methyloxolan-2-yl)methyl 3-(3-aminophenyl)propanoate |
|---|---|
| PubChem CID | 103137050 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (5-methyloxolan-2-yl)methyl 3-(3-aminophenyl)propanoate |
| SMILES | CC1CCC(COC(=O)CCc2cccc(N)c2)O1 |
| InChI | InChI=1S/C15H21NO3/c1-11-5-7-14(19-11)10-18-15(17)8-6-12-3-2-4-13(16)9-12/h2-4,9,11,14H,5-8,10,16H2,1H3 |
| InChIKey | FDTIWWCGMZXDRC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|