C16H15BrFNO2 — CID 62815629
(2,5-dimethylphenyl)methyl 5-amino-2-bromo-4-fluorobenzoate (PubChem CID 62815629) has the molecular formula C16H15BrFNO2 and a molecular weight of 352.20 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 5-amino-2-bromo-4-fluorobenzoate.
| Compound Name | (2,5-dimethylphenyl)methyl 5-amino-2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 62815629 |
| Molecular Formula | C16H15BrFNO2 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 5-amino-2-bromo-4-fluorobenzoate |
| SMILES | Cc1ccc(C)c(COC(=O)c2cc(N)c(F)cc2Br)c1 |
| InChI | InChI=1S/C16H15BrFNO2/c1-9-3-4-10(2)11(5-9)8-21-16(20)12-6-15(19)14(18)7-13(12)17/h3-7H,8,19H2,1-2H3 |
| InChIKey | SRSNLQFBYXEUGQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|