C24H26N2O3 — CID 2091356
[2-oxo-2-(3-phenylpropylamino)ethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate (PubChem CID 2091356) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 2091356 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)NCCCc2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H26N2O3/c1-18-16-22(19(2)26(18)21-13-7-4-8-14-21)24(28)29-17-23(27)25-15-9-12-20-10-5-3-6-11-20/h3-8,10-11,13-14,16H,9,12,15,17H2,1-2H3,(H,25,27) |
| InChIKey | LXFHYCFSNTWPNG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|