C20H20N2O5S — CID 8006710
[2-(3,4-dimethylanilino)-2-oxoethyl] 3-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 8006710) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 3-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 3-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8006710 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 3-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C20H20N2O5S/c1-4-10-21-28(25,26)18-7-5-6-16(12-18)20(24)27-13-19(23)22-17-9-8-14(2)15(3)11-17/h1,5-9,11-12,21H,10,13H2,2-3H3,(H,22,23) |
| InChIKey | VYFXIYDXJXCDFV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|