C18H24N2O7S — CID 7829699
[2-(ethoxycarbonylamino)-2-oxoethyl] 3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 7829699) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7829699 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C18H24N2O7S/c1-3-26-18(23)19-16(21)12-27-17(22)14-8-6-9-15(11-14)28(24,25)20-10-5-4-7-13(20)2/h6,8-9,11,13H,3-5,7,10,12H2,1-2H3,(H,19,21,23)/t13-/m1/s1 |
| InChIKey | FKLKCRPASXFGFD-CYBMUJFWSA-N |
| XLogP | 1.68 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |