C17H23N3O7S — CID 16528817
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 16528817) has the molecular formula C17H23N3O7S and a molecular weight of 413.45 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16528817 |
| Molecular Formula | C17H23N3O7S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1C |
| InChI | InChI=1S/C17H23N3O7S/c1-3-18-17(23)19-15(21)11-27-16(22)14-10-13(5-4-12(14)2)28(24,25)20-6-8-26-9-7-20/h4-5,10H,3,6-9,11H2,1-2H3,(H2,18,19,21,23) |
| InChIKey | RKDLZYXTLIRJFW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |