C20H15FN2O4 — CID 7284172
[2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 1-benzofuran-2-carboxylate (PubChem CID 7284172) has the molecular formula C20H15FN2O4 and a molecular weight of 366.35 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7284172 |
| Molecular Formula | C20H15FN2O4 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 1-benzofuran-2-carboxylate |
| SMILES | N#CCCN(C(=O)COC(=O)c1cc2ccccc2o1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FN2O4/c21-15-6-8-16(9-7-15)23(11-3-10-22)19(24)13-26-20(25)18-12-14-4-1-2-5-17(14)27-18/h1-2,4-9,12H,3,11,13H2 |
| InChIKey | AKYPNBNWOIWWFE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |