C23H19FN2O5 — CID 31958823
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate (PubChem CID 31958823) has the molecular formula C23H19FN2O5 and a molecular weight of 422.41 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 31958823 |
| Molecular Formula | C23H19FN2O5 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate |
| SMILES | N#CCCN(C(=O)COC(=O)c1ccc(COc2ccc(F)cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C23H19FN2O5/c24-17-7-9-19(10-8-17)29-15-20-11-12-21(31-20)23(28)30-16-22(27)26(14-4-13-25)18-5-2-1-3-6-18/h1-3,5-12H,4,14-16H2 |
| InChIKey | OOWRQGZGGPLZLD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |