C19H20ClNO5S — CID 7823745
[2-oxo-2-(4-propan-2-ylphenyl)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 7823745) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7823745 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCC(=O)c2ccc(C(C)C)cc2)ccc1Cl |
| InChI | InChI=1S/C19H20ClNO5S/c1-12(2)13-4-6-14(7-5-13)17(22)11-26-19(23)15-8-9-16(20)18(10-15)27(24,25)21-3/h4-10,12,21H,11H2,1-3H3 |
| InChIKey | SSKSXDQZVBUEIO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |