C16H17ClN2O5S2 — CID 7823627
[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 7823627) has the molecular formula C16H17ClN2O5S2 and a molecular weight of 416.91 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7823627 |
| Molecular Formula | C16H17ClN2O5S2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCC(=O)N[C@@H](C)c2cccs2)ccc1Cl |
| InChI | InChI=1S/C16H17ClN2O5S2/c1-10(13-4-3-7-25-13)19-15(20)9-24-16(21)11-5-6-12(17)14(8-11)26(22,23)18-2/h3-8,10,18H,9H2,1-2H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | NOWQQMFVHBXWHD-JTQLQIEISA-N |
| XLogP | 2.34 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |