(3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate

C17H17NO3 — CID 103999589

IUPAC(3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate
SMILESCOc1cccc(COC(=O)c2ccc3c(c2)CNC3)c1
InChIInChI=1S/C17H17NO3/c1-20-16-4-2-3-12(7-16)11-21-17(19)13-5-6-14-9-18-10-15(14)8-13/h2-8,18H,9-11H2,1H3
InChIKeyMHNYLAIMUJRRNG-UHFFFAOYSA-N
MW283.33 g/mol
LogP2.66
Rot. Bonds4

About (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate

(3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate (PubChem CID 103999589) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate.

Molecular Properties

Compound Name(3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate
PubChem CID103999589
Molecular FormulaC17H17NO3
Molecular Weight283.33 g/mol
Exact Mass283.12
IUPAC Name(3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate
SMILESCOc1cccc(COC(=O)c2ccc3c(c2)CNC3)c1
InChIInChI=1S/C17H17NO3/c1-20-16-4-2-3-12(7-16)11-21-17(19)13-5-6-14-9-18-10-15(14)8-13/h2-8,18H,9-11H2,1H3
InChIKeyMHNYLAIMUJRRNG-UHFFFAOYSA-N
XLogP2.66
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.33
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate?
The IUPAC name of (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate (CID 103999589) is (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate.
What is the SMILES notation for (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate?
The canonical SMILES for (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate is COc1cccc(COC(=O)c2ccc3c(c2)CNC3)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate?
The InChIKey is MHNYLAIMUJRRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-20-16-4-2-3-12(7-16)11-21-17(19)13-5-6-14-9-18-10-15(14)8-13/h2-8,18H,9-11H2,1H3.
What are the key properties of (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate?
(3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate has a molecular weight of 283.33 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 2,3-dihydro-1H-isoindole-5-carboxylate is sourced from PubChem (CID 103999589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).